1-amino-4-hydroxy-2-(2-phenoxyethoxy)anthracene-9,10-dione
Modify Date: 2024-02-20 11:37:01
1-amino-4-hydroxy-2-(2-phenoxyethoxy)anthracene-9,10-dione structure
|
Common Name | 1-amino-4-hydroxy-2-(2-phenoxyethoxy)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 17418-59-6 | Molecular Weight | 375.37400 | |
| Density | 1.397g/cm3 | Boiling Point | 659.9ºC at 760mmHg | |
| Molecular Formula | C22H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.9ºC | |
| Name | 1-amino-4-hydroxy-2-(2-phenoxyethoxy)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 659.9ºC at 760mmHg |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.37400 |
| Flash Point | 352.9ºC |
| Exact Mass | 375.11100 |
| PSA | 98.85000 |
| LogP | 3.78880 |
| Vapour Pressure | 5.07E-18mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | QIQBPLFYOLFHTB-UHFFFAOYSA-N |
| SMILES | Nc1c(OCCOc2ccccc2)cc(O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 241-443-1 |