4-Guanidino-2-methoxybenzoic acid structure
|
Common Name | 4-Guanidino-2-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 173731-96-9 | Molecular Weight | 209.20200 | |
| Density | 1.41g/cm3 | Boiling Point | 380.2ºC at 760 mmHg | |
| Molecular Formula | C9H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | 4-Guanidino-2-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760 mmHg |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20200 |
| Flash Point | 183.7ºC |
| Exact Mass | 209.08000 |
| PSA | 108.43000 |
| LogP | 1.57180 |
| Vapour Pressure | 1.86E-06mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | GYYCWERYJWNAKZ-UHFFFAOYSA-N |
| SMILES | COc1cc(N=C(N)N)ccc1C(=O)O |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(diaminomethylideneamino)-2-methoxybenzoic acid |