Benzenepropanamide,N-(3-nitrophenyl)-b-oxo- structure
|
Common Name | Benzenepropanamide,N-(3-nitrophenyl)-b-oxo- | ||
|---|---|---|---|---|
| CAS Number | 1734-36-7 | Molecular Weight | 284.26700 | |
| Density | 1.351g/cm3 | Boiling Point | 531.2ºC at 760mmHg | |
| Molecular Formula | C15H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.1ºC | |
| Name | N-(3-nitrophenyl)-3-oxo-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 531.2ºC at 760mmHg |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.26700 |
| Flash Point | 275.1ºC |
| Exact Mass | 284.08000 |
| PSA | 91.99000 |
| LogP | 3.40250 |
| Vapour Pressure | 2.29E-11mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | UUAFEFWRZSBGTL-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccccc1)Nc1cccc([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzenepropanam... CAS#:1734-36-7 |
| Literature: Eastman Kodak Co. Patent: US2448939 , 1944 ; Full Text Show Details Eastman Kodak Co. Patent: US2412700 , 1944 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| benzoyl-m-nitroacetanilide |