1-(Hydroxymethyl)-β-carboline structure
|
Common Name | 1-(Hydroxymethyl)-β-carboline | ||
|---|---|---|---|---|
| CAS Number | 17337-22-3 | Molecular Weight | 198.22100 | |
| Density | 1.385g/cm3 | Boiling Point | 466ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.6ºC | |
| Name | 9H-pyrido[3,4-b]indol-1-ylmethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385g/cm3 |
|---|---|
| Boiling Point | 466ºC at 760 mmHg |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22100 |
| Flash Point | 235.6ºC |
| Exact Mass | 198.07900 |
| PSA | 48.91000 |
| LogP | 2.20840 |
| Vapour Pressure | 1.74E-09mmHg at 25°C |
| Index of Refraction | 1.795 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-hydroxymethyl-9H-pyrido[3,4-b]indole |
| 1-Hydroxymethyl-9H-pyrido<3,4-b>indol |
| 9H-Pyrido[3,4-B]indole-1-methanol |
| InChI=1/C12H10N2O/c15-7-11-12-9(5-6-13-11)8-3-1-2-4-10(8)14-12/h1-6,14-15H,7H |