7-chloro-1-methyl-5-(4-oxocyclohexa-2,5-dien-1-ylidene)-3,4-dihydro-1,4-benzodiazepin-2-one structure
|
Common Name | 7-chloro-1-methyl-5-(4-oxocyclohexa-2,5-dien-1-ylidene)-3,4-dihydro-1,4-benzodiazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 17311-35-2 | Molecular Weight | 300.74000 | |
| Density | 1.354g/cm3 | Boiling Point | 606.7ºC at 760mmHg | |
| Molecular Formula | C16H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.7ºC | |
| Name | 7-chloro-1-methyl-5-(4-oxocyclohexa-2,5-dien-1-ylidene)-3,4-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 606.7ºC at 760mmHg |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.74000 |
| Flash Point | 320.7ºC |
| Exact Mass | 300.06700 |
| PSA | 49.41000 |
| LogP | 2.70600 |
| Vapour Pressure | 1.14E-14mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | IQFWLIWUKIFGKP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN=C(c2ccc(O)cc2)c2cc(Cl)ccc21 |
| HS Code | 2933990090 |
|---|
|
~%
7-chloro-1-meth... CAS#:17311-35-2
Detail
|
| Literature: Zomorodi; Carlile; Houston Xenobiotica, 1995 , vol. 25, # 9 p. 907 - 916 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4'-Hydroxydiazepam |
| 7-chloro-5-(4-hydroxy-phenyl)-1-methyl-1,3-dihydro-benzo[e][1,4]diazepin-2-one |
| Ro 7-3351 |
| 7-Chloro-1,3-dihydro-5-(4-hydroxyphenyl)-1-methyl-2H-1,4-benzodiazepin-2-on |
| 2H-1,4-Benzodiazepin-2-one,7-chloro-1,3-dihydro-5-(4-hydroxyphenyl)-1-methyl |
| Ba 2824 |
| p-hydroxydiazepam |