Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester mixt. with N-[[[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide structure
|
Common Name | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester mixt. with N-[[[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 173072-61-2 | Molecular Weight | 884.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H23BrCl3F8N2O6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phosphorothioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester mixt. with N-[[[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide |
|---|
| Molecular Formula | C28H23BrCl3F8N2O6PS |
|---|---|
| Molecular Weight | 884.8 |