sodium,2-chlorobenzoate structure
|
Common Name | sodium,2-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 17264-74-3 | Molecular Weight | 178.54800 | |
| Density | N/A | Boiling Point | 275.7ºC at 760mmHg | |
| Molecular Formula | C7H4ClNaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5ºC | |
| Name | sodium,2-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 275.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H4ClNaO2 |
| Molecular Weight | 178.54800 |
| Flash Point | 120.5ºC |
| Exact Mass | 177.98000 |
| PSA | 40.13000 |
| LogP | 0.70350 |
| Vapour Pressure | 0.00242mmHg at 25°C |
| InChIKey | OJLSABVGUWNJKD-UHFFFAOYSA-M |
| SMILES | O=C([O-])c1ccccc1Cl.[Na+] |
| HS Code | 2916399090 |
|---|
|
~%
sodium,2-chloro... CAS#:17264-74-3 |
| Literature: D'Anna, Francesca; Marullo, Salvatore; Vitale, Paola; Noto, Renato Journal of Organic Chemistry, 2010 , vol. 75, # 14 p. 4828 - 4834 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| sodium 2-chlorobenzoate |
| OR5177X |
| o-Chlorobenzoic acid sodiumsalt |
| sodium chlorobenzoate |
| sodium o-chlorobenzoate |
| Benzoic acid,2-chloro-,sodium salt |
| o-chloro-sodium benzoate |
| EINECS 241-297-9 |
| 2-chloro-benzoic acid,sodium salt |