Propanamide,N-[1,1'-biphenyl]-2-yl-2-methyl- structure
|
Common Name | Propanamide,N-[1,1'-biphenyl]-2-yl-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 17261-12-0 | Molecular Weight | 239.31200 | |
| Density | 1.081g/cm3 | Boiling Point | 393.9ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239ºC | |
| Name | 2-methyl-N-(2-phenylphenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 393.9ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 239ºC |
| Exact Mass | 239.13100 |
| PSA | 29.10000 |
| LogP | 4.02110 |
| Vapour Pressure | 2.06E-06mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | AASQSYFHIKUNTB-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)Nc1ccccc1-c1ccccc1 |
|
~%
Propanamide,N-[... CAS#:17261-12-0 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1957 , p. 505,507 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Isobutyrylamino-biphenyl |
| N-biphenyl-2-yl-isobutyramide |