Fepentolic
Modify Date: 2025-08-23 10:15:52
Fepentolic structure
|
Common Name | Fepentolic | ||
|---|---|---|---|---|
| CAS Number | 17243-33-3 | Molecular Weight | 224.25300 | |
| Density | 1.185g/cm3 | Boiling Point | 379.8ºC at 760mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | 3-hydroxy-2-(1-hydroxypentyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 379.8ºC at 760mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25300 |
| Flash Point | 144.5ºC |
| Exact Mass | 224.10500 |
| PSA | 77.76000 |
| LogP | 2.31400 |
| Index of Refraction | 1.55 |
| InChIKey | SQHQDVNANXVULC-UHFFFAOYSA-N |
| SMILES | CCCCC(O)c1cc(C(=O)O)ccc1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| unii-2y3q6049lx |