5,5'-Dibromo-4,4'-dinonyl-2,2'-bi-1,3-thiazole structure
|
Common Name | 5,5'-Dibromo-4,4'-dinonyl-2,2'-bi-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 172100-44-6 | Molecular Weight | 578.510 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 600.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C24H38Br2N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.9±34.3 °C | |
| Name | 5-bromo-2-(5-bromo-4-nonyl-1,3-thiazol-2-yl)-4-nonyl-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 600.4±65.0 °C at 760 mmHg |
| Molecular Formula | C24H38Br2N2S2 |
| Molecular Weight | 578.510 |
| Flash Point | 316.9±34.3 °C |
| Exact Mass | 576.084290 |
| PSA | 82.26000 |
| LogP | 13.08 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | NVYFBJQBTRFBCJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1nc(-c2nc(CCCCCCCCC)c(Br)s2)sc1Br |
| HS Code | 2934100090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,2'-Bithiazole, 5,5'-dibromo-4,4'-dinonyl- |
| 5,5'-Dibromo-4,4'-dinonyl-2,2'-bi-1,3-thiazole |
| 5,5'-dibromo-4,4'-dinonyl-2,2'-bithiazole |