Piperazine Ferulate structure
|
Common Name | Piperazine Ferulate | ||
|---|---|---|---|---|
| CAS Number | 171876-65-6 | Molecular Weight | 280.320 | |
| Density | 1.061 g/cm3 | Boiling Point | 425.791ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.915ºC | |
| Name | Piperazine ferulate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061 g/cm3 |
|---|---|
| Boiling Point | 425.791ºC at 760 mmHg |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.320 |
| Flash Point | 144.915ºC |
| Exact Mass | 280.142303 |
| PSA | 90.82000 |
| LogP | 1.33540 |
| InChIKey | MUQIDFWDLOFXEP-WGCWOXMQSA-N |
| SMILES | C1CNCCN1.COc1cc(C=CC(=O)O)ccc1O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Ethylhexyl ferulate |
| MFCD03428534 |
| Piperazine 3-methoxy-4-hydroxycinnamate |
| 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (2E)-, compd. with piperazine (1:1) |
| (2E)-3-(4-Hydroxy-3-methoxyphenyl)acrylic acid - piperazine (1:1) |