2,4(1H,3H)-Pyrimidinedione,5-[(4-hydroxyphenyl)methyl]-
Modify Date: 2025-09-12 11:41:47
![2,4(1H,3H)-Pyrimidinedione,5-[(4-hydroxyphenyl)methyl]- Structure](https://image.chemsrc.com/caspic/316/17187-50-7.png)
2,4(1H,3H)-Pyrimidinedione,5-[(4-hydroxyphenyl)methyl]- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,5-[(4-hydroxyphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 17187-50-7 | Molecular Weight | 218.20900 | |
| Density | 1.367g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-hydroxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Exact Mass | 218.06900 |
| PSA | 85.95000 |
| LogP | 0.35960 |
| Index of Refraction | 1.62 |
| InChIKey | MBFIUTNZUFHGGN-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cc(Cc2ccc(O)cc2)c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~94%
2,4(1H,3H)-Pyri... CAS#:17187-50-7 |
| Literature: Stuart; Paterson; Roth; Aig Journal of Medicinal Chemistry, 1983 , vol. 26, # 5 p. 667 - 673 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Uracil,5-(p-hydroxybenzyl) |
| 5-(p-Hydroxybenzyl)-uracil |
| 5-(4-Hydroxy-benzyl)-uracil |
| CCG-6905 |
| 5-(4-hydroxy-benzyl)-1H-pyrimidine-2,4-dione |