4'-Hydroxy-3'-[(4-methyl-1-piperazinyl)methyl]-4-nitrobenzanilide structure
|
Common Name | 4'-Hydroxy-3'-[(4-methyl-1-piperazinyl)methyl]-4-nitrobenzanilide | ||
|---|---|---|---|---|
| CAS Number | 17183-43-6 | Molecular Weight | 370.40200 | |
| Density | 1.341g/cm3 | Boiling Point | 496.5ºC at 760mmHg | |
| Molecular Formula | C19H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | N-[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760mmHg |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.40200 |
| Flash Point | 254ºC |
| Exact Mass | 370.16400 |
| PSA | 105.12000 |
| LogP | 3.08310 |
| Vapour Pressure | 1.76E-10mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | XPZJSNCMERDPCW-UHFFFAOYSA-N |
| SMILES | CN1CCN(Cc2cc(NC(=O)c3ccc([N+](=O)[O-])cc3)ccc2O)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| lg 259 |