(-)-menthyl lactate structure
|
Common Name | (-)-menthyl lactate | ||
|---|---|---|---|---|
| CAS Number | 17162-29-7 | Molecular Weight | 228.328 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 304.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C13H24O3 | Melting Point | 42-47°C | |
| MSDS | N/A | Flash Point | 116.0±13.2 °C | |
| Name | Menthyl Lactate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.0±15.0 °C at 760 mmHg |
| Melting Point | 42-47°C |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.328 |
| Flash Point | 116.0±13.2 °C |
| Exact Mass | 228.172546 |
| PSA | 46.53000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.468 |
| InChIKey | UJNOLBSYLSYIBM-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C(C)O)C1 |
| HS Code | 2918110000 |
|---|
|
~%
(-)-menthyl lactate CAS#:17162-29-7 |
| Literature: Journal of Organic Chemistry, , vol. 42, p. 1671 - 1679 |
|
~%
(-)-menthyl lactate CAS#:17162-29-7 |
| Literature: Tetrahedron: Asymmetry, , vol. 2, # 8 p. 771 - 774 |
|
~%
(-)-menthyl lactate CAS#:17162-29-7 |
| Literature: Tetrahedron: Asymmetry, , vol. 5, # 10 p. 1873 - 1874 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918110000 |
|---|---|
| Summary | 2918110000. lactic acid, its salts and esters. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| UNII:XFS8QYW6WY |
| Menthyl lactate |
| Propanoic acid, 2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, (2R)- |
| 2-Isopropyl-5-methylcyclohexyl 2-hydroxypropanoate |
| lactic acid menthyl ester |
| (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl (2R)-2-hydroxypropanoate |