1,2,4,5-Tetrakis(trimethylsilyl)benzene structure
|
Common Name | 1,2,4,5-Tetrakis(trimethylsilyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 17156-61-5 | Molecular Weight | 366.83600 | |
| Density | 0.85g/cm3 | Boiling Point | 274.6ºC at 760mmHg | |
| Molecular Formula | C18H38Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85ºC | |
| Name | trimethyl-[2,4,5-tris(trimethylsilyl)phenyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.85g/cm3 |
|---|---|
| Boiling Point | 274.6ºC at 760mmHg |
| Molecular Formula | C18H38Si4 |
| Molecular Weight | 366.83600 |
| Flash Point | 85ºC |
| Exact Mass | 366.20500 |
| LogP | 3.86740 |
| Vapour Pressure | 0.00896mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | IKBMPVFDRAQKNI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cc([Si](C)(C)C)c([Si](C)(C)C)cc1[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2,4,5-tetrakis-trimethylsilanyl-benzene |
| dodeca-Si-methyl-Si,Si',Si'',Si'''-benzene-1,2,4,5-tetrayl-tetrakis-silane |