m-Toluoyl and benzoyl peroxide
Modify Date: 2025-08-26 12:06:49
m-Toluoyl and benzoyl peroxide structure
|
Common Name | m-Toluoyl and benzoyl peroxide | ||
|---|---|---|---|---|
| CAS Number | 1712-87-4 | Molecular Weight | 270.28000 | |
| Density | 1.198g/cm3 | Boiling Point | 404.508ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.191ºC | |
| Name | (3-methylbenzoyl) 3-methylbenzenecarboperoxoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 404.508ºC at 760 mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 179.191ºC |
| Exact Mass | 270.08900 |
| PSA | 52.60000 |
| LogP | 3.23220 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | NLBJAOHLJABDAU-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)OOC(=O)c2cccc(C)c2)c1 |
| HS Code | 2916399090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
CAS#:1711-06-4| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Peroxide,bis(3-methylbenzoyl) |
| Nyper MT 80 |
| di-m-toluoyl peroxide |
| m-Methylbenzoyl peroxide |
| Bis-<3-methylbenzoyl>-peroxid |
| Nyper MT |
| (3-methylphenyl)carbonyl 3-methylbenzenecarboperoxoate |
| Di-(2-methylbenzoyl)peroxide |
| Di-m-toluoyl-peroxid |
| m-Toluoyl peroxide |
| bis(m-methylbenzoyl)-peroxide |
| bis-(m-toluoyl)peroxide |