Boc-5-Amino-2-fluoropyridine structure
|
Common Name | Boc-5-Amino-2-fluoropyridine | ||
|---|---|---|---|---|
| CAS Number | 171178-41-9 | Molecular Weight | 212.221 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 258.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H13FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.0±23.2 °C | |
| Name | tert-butyl N-(6-fluoropyridin-3-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 258.3±25.0 °C at 760 mmHg |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.221 |
| Flash Point | 110.0±23.2 °C |
| Exact Mass | 212.096100 |
| PSA | 51.22000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | FXGNEIOGSGKPFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)nc1 |
| HS Code | 2933399090 |
|---|
|
~95%
Boc-5-Amino-2-f... CAS#:171178-41-9 |
| Literature: Wyeth Holdings Corporation Patent: EP1171440 B1, 2004 ; Location in patent: Page 53 ; |
|
~%
Boc-5-Amino-2-f... CAS#:171178-41-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 6 p. 1411 - 1416 |
|
~%
Boc-5-Amino-2-f... CAS#:171178-41-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 6 p. 1411 - 1416 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl (6-fluoro-3-pyridinyl)carbamate |
| FC0265 |
| N-Boc-5-amino-2-fluoropyridine |
| Boc-5-Amino-2-fluoropyridine |
| tert-Butyl (6-fluoropyridin-3-yl)carbamate |
| tert-butyl 6-fluoropyridin-3-ylcarbamate |
| Carbamic acid, N-(6-fluoro-3-pyridinyl)-, 1,1-dimethylethyl ester |
| AB2738 |