4,5-dihydro-1,3-thiazol-2-amine,4-(4-methoxyanilino)-4-oxobutanoic acid structure
|
Common Name | 4,5-dihydro-1,3-thiazol-2-amine,4-(4-methoxyanilino)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 171088-74-7 | Molecular Weight | 325.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-dihydro-1,3-thiazol-2-amine,4-(4-methoxyanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19N3O4S |
|---|---|
| Molecular Weight | 325.38300 |
| Exact Mass | 325.11000 |
| PSA | 136.81000 |
| LogP | 2.25760 |
| Vapour Pressure | 1.71E-10mmHg at 25°C |
| InChIKey | GLEMCTVKJLMGRO-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)CCC(=O)O)cc1.NC1=NCCS1 |
| 4-((4-Methoxyphenyl)amino)-4-oxobutanoic acid compd. with 4,5-dihydro-2-thiazolamine (1:1) |
| AmbscPOD_07/0762 |
| Butanoic acid,4-((4-methoxyphenyl)amino)-4-oxo-,compd. with 4,5-dihydro-2-thiazolamine (1:1) |