4-(acryloylamino)benzamide
Modify Date: 2025-09-23 14:14:04
4-(acryloylamino)benzamide structure
|
Common Name | 4-(acryloylamino)benzamide | ||
|---|---|---|---|---|
| CAS Number | 17090-31-2 | Molecular Weight | 190.19900 | |
| Density | 1.244g/cm3 | Boiling Point | 444.7ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | 4-(prop-2-enoylamino)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 444.7ºC at 760 mmHg |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.19900 |
| Flash Point | 222.7ºC |
| Exact Mass | 190.07400 |
| PSA | 72.19000 |
| LogP | 1.68330 |
| Vapour Pressure | 4.19E-08mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | XNZARJWTVPTCFX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Nc1ccc(C(N)=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 241-151-4 |
| 4-Acryloylamino-benzamid |