Acetone peroxide structure
|
Common Name | Acetone peroxide | ||
|---|---|---|---|---|
| CAS Number | 17088-37-8 | Molecular Weight | 222.23600 | |
| Density | 1.005g/cm3 | Boiling Point | 184.93ºC at 760 mmHg | |
| Molecular Formula | C9H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 51.467ºC | |
| Name | 3,3,6,6,9,9-hexamethyl-1,2,4,5,7,8-hexaoxonane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 184.93ºC at 760 mmHg |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.23600 |
| Flash Point | 51.467ºC |
| Exact Mass | 222.11000 |
| PSA | 55.38000 |
| LogP | 2.05290 |
| Vapour Pressure | 0.98mmHg at 25°C |
| Index of Refraction | 1.382 |
| InChIKey | ZTLXICJMNFREPA-UHFFFAOYSA-N |
| SMILES | CC1(C)OOC(C)(C)OOC(C)(C)OO1 |
| HS Code | 2914190090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| UNII-62T938ZGDD |
| 3,3,6,6,9,9-Hexamethyl-1,2,4,5,7,8-hexaoxacyclononane |
| Acetone peroxide trimer |
| acetone peroxide |
| Peroxyacetone |
| 3,3,6,6,9,9-hexamethyl-1,4,7-cyclononatriperoxane |
| TATP cpd |
| Acetone cyclic triperoxide |
| Triacetone triperoxide |
| Mother of Satan |
| Acetone triperoxide |