Ipamorelin structure
|
Common Name | Ipamorelin | ||
|---|---|---|---|---|
| CAS Number | 170851-70-4 | Molecular Weight | 711.853 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1185.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C38H49N9O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 670.7±34.3 °C | |
Use of IpamorelinIpamorelin, also known as NNC-26-0161, is a a ghrelin mimetic. Ipamorelin counteracts glucocorticoid-induced decrease in bone formation of adult rats. Ipamorelin may ameliorate the symptoms in patients with POI. Ipamorelin accelerates gastric emptying in a rodent model of postoperative ileus through the stimulation of gastric contractility by activating a ghrelin receptor-mediated mechanism involving cholinergic excitatory neurons. |
| Name | (2S)-6-amino-2-[[(2R)-2-[[(2R)-2-[[(2S)-2-[(2-amino-2-methylpropanoyl)amino]-3-(4H-imidazol-4-yl)propanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1185.5±65.0 °C at 760 mmHg |
| Molecular Formula | C38H49N9O5 |
| Molecular Weight | 711.853 |
| Flash Point | 670.7±34.3 °C |
| Exact Mass | 711.385681 |
| PSA | 240.21000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | NEHWBYHLYZGBNO-BVEPWEIPSA-N |
| SMILES | CC(C)(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(N)=O |
| L-Lysinamide, 2-methylalanyl-L-histidyl-3-(2-naphthalenyl)-D-alanyl-D-phenylalanyl- |
| UNII-Y9M3S784Z6 |
| Y9M3S784Z6 |
| 2-Methylalanyl-L-histidyl-3-(2-naphthalenyl)-D-alanyl-D-phenylalanyl-L-lysinamide |
| Ipamorelin |
| 2-Methylalanyl-L-histidyl-3-(2-naphthyl)-D-alanyl-D-phenylalanyl-L-lysinamide. |
| 2-Methylalanyl-L-histidyl-3-(2-naphthyl)-D-alanyl-D-phenylalanyl-L-lysinamide |