a-D-Galactopyranoside,4-nitrophenyl, 2,3,4,6-tetraacetate
Modify Date: 2025-09-12 19:59:35
a-D-Galactopyranoside,4-nitrophenyl, 2,3,4,6-tetraacetate structure
|
Common Name | a-D-Galactopyranoside,4-nitrophenyl, 2,3,4,6-tetraacetate | ||
|---|---|---|---|---|
| CAS Number | 17042-39-6 | Molecular Weight | 469.39600 | |
| Density | 1.38g/cm3 | Boiling Point | 559.3ºC at 760mmHg | |
| Molecular Formula | C20H23NO12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.1ºC | |
| Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 559.3ºC at 760mmHg |
| Molecular Formula | C20H23NO12 |
| Molecular Weight | 469.39600 |
| Flash Point | 207.1ºC |
| Exact Mass | 469.12200 |
| PSA | 169.48000 |
| LogP | 1.57990 |
| Vapour Pressure | 1.53E-12mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | BEUISCKWILNFIL-CXQPBAHBSA-N |
| SMILES | CC(=O)OCC1OC(Oc2ccc([N+](=O)[O-])cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|
~0%
a-D-Galactopyra... CAS#:17042-39-6 |
| Literature: Apparu, Maecel; Blanc-Muesser, Michele; Defaye, Jacques; Driguez, Hugues Canadian Journal of Chemistry, 1981 , vol. 59, p. 314 - 320 |
CAS#:3150-24-1
CAS#:5094-33-7
CAS#:7493-95-0| 4-Nitrophenyl 2,3,4,6-tetra-O-acetyl-a-D-galactopyranoside |
| 4-Nitrophenyl a-D-Galactopyranoside 2,3,4,6-Tetraacetate |
| p-Nitrophenyl 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranoside |