(4-((diethylamino)Methyl)-2-fluorophenyl)boronic acid
Modify Date: 2025-09-28 18:06:21
(4-((diethylamino)Methyl)-2-fluorophenyl)boronic acid structure
|
Common Name | (4-((diethylamino)Methyl)-2-fluorophenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 1704064-27-6 | Molecular Weight | 172.023 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 215.3±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H6BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 84.0±21.8 °C | |
| Name | 2-Bromo-3-methylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 215.3±20.0 °C at 760 mmHg |
| Molecular Formula | C6H6BrN |
| Molecular Weight | 172.023 |
| Flash Point | 84.0±21.8 °C |
| Exact Mass | 170.968353 |
| LogP | 1.99 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | ULUKGDOJHNTXSR-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1ccc(B(O)O)c(F)c1 |
| Storage condition | 2-8°C |
| Pyridine, 2-bromo-3-methyl- |
| 107896 |
| T6NJ BE C1 |
| 2-Bromo-3-methylpyridine |
| 2-Bromo-3-picoline |