Benzoic acid,4-(phenylamino)- structure
|
Common Name | Benzoic acid,4-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 17040-20-9 | Molecular Weight | 213.23200 | |
| Density | 1.269g/cm3 | Boiling Point | 408.2ºC at 760mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.7ºC | |
| Name | 4-anilinobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 408.2ºC at 760mmHg |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 200.7ºC |
| Exact Mass | 213.07900 |
| PSA | 49.33000 |
| LogP | 3.20140 |
| Vapour Pressure | 2.13E-07mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | DPAMLADQPZFXMD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Nc2ccccc2)cc1 |
| HS Code | 2922499990 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-Anilino-benzoesaeure |
| 4-anilino-benzoic acid |
| 4-phenylamino-benzoic acid |