Boron, bis[m-(4-bromo-1H-pyrazolato-N1:N2)tetrahydrodi-(9CI) structure
|
Common Name | Boron, bis[m-(4-bromo-1H-pyrazolato-N1:N2)tetrahydrodi-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 16998-93-9 | Molecular Weight | 315.56900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6B2Br2N4 | Melting Point | 140-142ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | {1-(4-bromo)pyrazolyl}borane |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 140-142ºC(lit.) |
|---|---|
| Molecular Formula | C6H6B2Br2N4 |
| Molecular Weight | 315.56900 |
| Exact Mass | 313.91500 |
| PSA | 26.64000 |
| LogP | 0.61900 |
| InChIKey | WSJBILWWGJIHKJ-UHFFFAOYSA-N |
| SMILES | Brc1cn2[n+](c1)[B-]n1cc(Br)c[n+]1[B-]2 |
| HS Code | 2934999090 |
|---|
|
~10%
Boron, bis[m-(4... CAS#:16998-93-9 |
| Literature: Gmelin Handbook: B: B-Verb.5, 1.2, page 2 - 7 |
|
~%
Boron, bis[m-(4... CAS#:16998-93-9
Detail
|
| Literature: Trofimenko,S. Journal of the American Chemical Society, 1967 , vol. 89, # 13 p. 3165 - 3170 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Dibromopyrazabole |