(2,5-dimethoxyphenyl)-(5-hydroxy-1-benzofuran-3-yl)methanone
Modify Date: 2025-09-28 22:15:17
(2,5-dimethoxyphenyl)-(5-hydroxy-1-benzofuran-3-yl)methanone structure
|
Common Name | (2,5-dimethoxyphenyl)-(5-hydroxy-1-benzofuran-3-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 169944-36-9 | Molecular Weight | 298.29000 | |
| Density | 1.291g/cm3 | Boiling Point | 520.9ºC at 760 mmHg | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
| Name | (2,5-dimethoxyphenyl)-(5-hydroxy-1-benzofuran-3-yl)methanone |
|---|
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760 mmHg |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29000 |
| Flash Point | 268.8ºC |
| Exact Mass | 298.08400 |
| PSA | 68.90000 |
| LogP | 3.38660 |
| Vapour Pressure | 1.81E-11mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | ZZXSSXYHBWCWGF-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)c2coc3ccc(O)cc23)c1 |
|
~%
(2,5-dimethoxyp... CAS#:169944-36-9 |
| Literature: Wu, Jiahui; Li, Yi; Chen, Kaixian; Jiang, Hualiang; Xu, Ming-Hua; Liu, Dongxiang European Journal of Medicinal Chemistry, 2013 , vol. 60, p. 441 - 450 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |