5-bromo-4-chloro-2-phenylpyridazin-3(2H)-one structure
|
Common Name | 5-bromo-4-chloro-2-phenylpyridazin-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 1698-63-1 | Molecular Weight | 285.52400 | |
| Density | 1.66g/cm3 | Boiling Point | 322.4ºC at 760mmHg | |
| Molecular Formula | C10H6BrClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.8ºC | |
| Name | 5-bromo-4-chloro-2-phenylpyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 322.4ºC at 760mmHg |
| Molecular Formula | C10H6BrClN2O |
| Molecular Weight | 285.52400 |
| Flash Point | 148.8ºC |
| Exact Mass | 283.93500 |
| PSA | 34.89000 |
| LogP | 2.64840 |
| Vapour Pressure | 0.00028mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | DKQRNDGOJIYNOY-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c(Br)cnn1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-4-chloro-2-phenylpyridazin-3(2H)-one |
| 1-Phenyl-4-brom-5-chlorpyridazon-6 |
| EINECS 216-921-8 |
| 5-bromo-4-chloro-2-phenyl-2H-pyridazin-3-one |