4-Chloro-7-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine structure
|
Common Name | 4-Chloro-7-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 169516-60-3 | Molecular Weight | 287.675 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 548.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C11H11ClFN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.5±30.1 °C | |
Use of 4-Chloro-7-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine6-Chloro-7-deazapurine-2F-β-D-arabinofuranose is a nucleoside derivative. 6-Chloro-7-deazapurine-2F-β-D-arabinofuranose can be used for synthesis of antiviral agent against hepatitis C virus infection[1]. |
| Name | 4-Chloro-7-(2-deoxy-2-fluoro-β-D-arabinofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Chloro-7-deazapurine-2F-β-D-arabinofuranose is a nucleoside derivative. 6-Chloro-7-deazapurine-2F-β-D-arabinofuranose can be used for synthesis of antiviral agent against hepatitis C virus infection[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 548.4±50.0 °C at 760 mmHg |
| Molecular Formula | C11H11ClFN3O3 |
| Molecular Weight | 287.675 |
| Flash Point | 285.5±30.1 °C |
| Exact Mass | 287.047302 |
| LogP | 0.33 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.734 |
| InChIKey | XFKDBYKOIYHLSC-FBSDJGSXSA-N |
| SMILES | OCC1OC(n2ccc3c(Cl)ncnc32)C(F)C1O |
| 4-Chloro-7-(2-deoxy-2-fluoro-β-D-arabinofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine |
| MFCD25542479 |
| 7H-Pyrrolo[2,3-d]pyrimidine, 4-chloro-7-(2-deoxy-2-fluoro-β-D-arabinofuranosyl)- |