(S)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate structure
|
Common Name | (S)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 169448-17-3 | Molecular Weight | 230.30400 | |
| Density | 1.067g/cm3 | Boiling Point | 339.1ºC at 760 mmHg | |
| Molecular Formula | C11H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.9ºC | |
| Name | (S)-tert-Butyl 2-(2-hydroxyethyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 339.1ºC at 760 mmHg |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.30400 |
| Flash Point | 158.9ºC |
| Exact Mass | 230.16300 |
| PSA | 61.80000 |
| LogP | 0.84440 |
| Vapour Pressure | 6.34E-06mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | OOZBHDCFUFVAOH-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1CCO |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl (2S)-2-(2-hydroxyethyl)piperazine-1-carboxylate |