BOC-TYR-OH DCHA structure
|
Common Name | BOC-TYR-OH DCHA | ||
|---|---|---|---|---|
| CAS Number | 16944-14-2 | Molecular Weight | 462.62200 | |
| Density | N/A | Boiling Point | 484.9ºC at 760mmHg | |
| Molecular Formula | C26H42N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.1ºC | |
| Name | N-cyclohexylcyclohexanamine,(2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 484.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C26H42N2O5 |
| Molecular Weight | 462.62200 |
| Flash Point | 247.1ºC |
| Exact Mass | 462.30900 |
| PSA | 107.89000 |
| LogP | 5.93580 |
| Vapour Pressure | 3.23E-10mmHg at 25°C |
| InChIKey | WLFHJXZLIRDBRG-MERQFXBCSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
|
~%
BOC-TYR-OH DCHA CAS#:16944-14-2 |
| Literature: Azuse; Tamura; Kinomura; Okai; Kouge; Hamatsu; Koizumi Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 10 p. 3103 - 3108 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| EINECS 241-013-3 |
| dicyclohexylamine salt of N-t-butyloxycarbonyl-L-tyrosine |
| N-t-Butyloxycarbonyl-L-tyrosin-Dicyclohexylaminsalz |
| BOC-Tyr*DCHA |
| Boc-Tyr-OH*DCHA |
| Boc-Tyr dicyclohexylammonium salt |