(5S)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one
![(5S)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one Structure](https://image.chemsrc.com/caspic/217/169297-84-1.png)
(5S)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one structure
|
Common Name | (5S)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one | ||
|---|---|---|---|---|
| CAS Number | 169297-84-1 | Molecular Weight | 235.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5S)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.27900 |
| Exact Mass | 235.12100 |
| PSA | 38.77000 |
| LogP | 1.38040 |
| InChIKey | DCCPSNCYDOCXEW-JTQLQIEISA-N |
| SMILES | COc1ccc(CN2C(=O)COCC2C)cc1 |
|
~%
(5S)-4-[(4-meth... CAS#:169297-84-1 |
| Literature: Norman, Bryan H.; Kroin, Julian S. Journal of Organic Chemistry, 1996 , vol. 61, # 15 p. 4990 - 4998 |
|
~%
(5S)-4-[(4-meth... CAS#:169297-84-1 |
| Literature: MERCK and CO., INC. Patent: WO2008/156726 A1, 2008 ; WO 2008/156726 A1 |
|
~%
(5S)-4-[(4-meth... CAS#:169297-84-1 |
| Literature: MERCK and CO., INC. Patent: WO2008/156726 A1, 2008 ; Location in patent: Page/Page column 124 ; WO 2008/156726 A1 |
|
~%
(5S)-4-[(4-meth... CAS#:169297-84-1 |
| Literature: MERCK and CO., INC. Patent: WO2008/156726 A1, 2008 ; WO 2008/156726 A1 |
|
~%
(5S)-4-[(4-meth... CAS#:169297-84-1 |
| Literature: MERCK and CO., INC. Patent: WO2008/156726 A1, 2008 ; WO 2008/156726 A1 |
![2-bromo-N-[(1S)-2-hydroxy-1-methylethyl]-N-(4-methoxybenzyl)acetamide structure](https://image.chemsrc.com/caspic/432/1093881-57-2.png)
![(2S)-2-{[(1E)-(4-methoxyphenyl)methylene]amino}propan-1-ol structure](https://image.chemsrc.com/caspic/091/86941-36-8.png)
| (5S)-4-(4-methoxybenzyl)-5-methylmorpholin-3-one |
| 3-Morpholinone,4-[(4-methoxyphenyl)methyl]-5-methyl-,(5S) |
| (5S)-4-(4-Methoxybenzyl)-5-methyl-3-morpholinone |
| (S)-5-methyl-4-(4-methoxybenzyl)morpholin-3-one |