FR179642
Modify Date: 2025-08-25 14:22:58
FR179642 structure
|
Common Name | FR179642 | ||
|---|---|---|---|---|
| CAS Number | 168110-44-9 | Molecular Weight | 936.894 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C35H52N8O20S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FR179642FR179642 is a key intermediate in the synthesis of the echinocandin antifungal Micafungin[1]. FR179642 is the cyclic peptide nucleus of the echinocandin-like antifungal lipopeptide FR901379[2]. |
| Name | fr179642 |
|---|---|
| Synonym | More Synonyms |
| Description | FR179642 is a key intermediate in the synthesis of the echinocandin antifungal Micafungin[1]. FR179642 is the cyclic peptide nucleus of the echinocandin-like antifungal lipopeptide FR901379[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C35H52N8O20S |
| Molecular Weight | 936.894 |
| Exact Mass | 936.301880 |
| PSA | 480.18000 |
| LogP | -12.95 |
| Index of Refraction | 1.718 |
| InChIKey | QCYMOOBOFFUBHZ-CPYYHODSSA-N |
| SMILES | CC(O)C1NC(=O)C(N)CC(O)C(O)NC(=O)C2C(O)C(C)CN2C(=O)C(C(O)CC(N)=O)NC(=O)C(C(O)C(O)c2ccc(O)c(OS(=O)(=O)O)c2)NC(=O)C2CC(O)CN2C1=O |
| 5-[(1S,2S)-2-{(2R,6S,9S,11R,12R,14aS,15S,16S,20S,23S,25aS)-9-Amino-20-[(1R)-3-amino-1-hydroxy-3-oxopropyl]-2,11,12,15-tetrahydroxy-6-[(1R)-1-hydroxyethyl]-16-methyl-5,8,14,19,22,25-hexaoxotetracosahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacyclohenicosin-23-yl}-1,2-dihydroxyethyl]-2-hydroxyphenyl hydrogen sulfate |
| Micafungin FR-179642 |
| 1H-Dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacycloheneicosine-20-propanamide, 9-amino-23-[(1S,2S)-1,2-dihydroxy-2-[4-hydroxy-3-(sulfooxy)phenyl]ethyl]tetracosahydro-β,2,11,12,15-pentahydroxy-6 -[(1R)-1-hydroxyethyl]-16-methyl-5,8,14,19,22,25-hexaoxo-, (βR,2R,6S,9S,11R,12R,14aS,15S,16S,20S,23S,25aS)- |
| FR-179642 |