2-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid
Modify Date: 2025-08-26 22:06:09
![2-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid Structure](https://image.chemsrc.com/caspic/018/168072-81-9.png)
2-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid structure
|
Common Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 168072-81-9 | Molecular Weight | 236.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O4 |
|---|---|
| Molecular Weight | 236.26400 |
| Exact Mass | 236.10500 |
| PSA | 63.60000 |
| LogP | 2.26900 |
| InChIKey | FVHGXAUPJLPAKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccccc1CC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Carboxymethylbenzoic acid tert-butyl ester |
| Benzeneacetic acid,2-[(1,1-dimethylethoxy)carbonyl] |