3'-Hydroxymirificin
Modify Date: 2025-08-21 20:08:40
3'-Hydroxymirificin structure
|
Common Name | 3'-Hydroxymirificin | ||
|---|---|---|---|---|
| CAS Number | 168035-02-7 | Molecular Weight | 564.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H28O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-Hydroxymirificin3'-Hydroxymirificin (compound 3) is a naural compound that can be isolated from Pueraria lobata roots. 3'-Hydroxymirificin (compound 3) possesses estrogenic activity and anti-proliferation of MCF-7 human breast carcinoma cells[1]. |
| Name | 3'-Hydroxymirificin |
|---|
| Description | 3'-Hydroxymirificin (compound 3) is a naural compound that can be isolated from Pueraria lobata roots. 3'-Hydroxymirificin (compound 3) possesses estrogenic activity and anti-proliferation of MCF-7 human breast carcinoma cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H28O14 |
|---|---|
| Molecular Weight | 564.49 |
| InChIKey | UXSOWCXXXQKAGC-QOIVFALESA-N |
| SMILES | O=c1c(-c2ccc(O)c(O)c2)coc2c(C3OC(COC4OCC(O)(CO)C4O)C(O)C(O)C3O)c(O)ccc12 |