benzyl 4-[amino(thiocarbonyl)]piperidine-1-carboxylate structure
|
Common Name | benzyl 4-[amino(thiocarbonyl)]piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 167757-46-2 | Molecular Weight | 278.37000 | |
| Density | 1.253g/cm3 | Boiling Point | 441.9ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O2S | Melting Point | 128ºC | |
| MSDS | N/A | Flash Point | 221.1ºC | |
| Name | benzyl 4-carbamothioylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 441.9ºC at 760 mmHg |
| Melting Point | 128ºC |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.37000 |
| Flash Point | 221.1ºC |
| Exact Mass | 278.10900 |
| PSA | 87.65000 |
| LogP | 2.95950 |
| Vapour Pressure | 5.24E-08mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | NOXHDLSQVLNVJA-UHFFFAOYSA-N |
| SMILES | NC(=S)C1CCN(C(=O)OCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzyl 4-(aminocarbonothioyl)piperidine-1-carboxylate |
| 1-Benzyloxycarbonyl-piperid-4-yl-thiocarboxylic acid amide |
| Piperidine-4-thiocarboxamide,N1-CBZ protected |
| 1-(phenylmethoxycarbonyl)-4-piperidylthiocarboxamide |
| benzyl-4-carbamothioylpiperidine-1-carboxylate |
| Benzyl 4-[amino(thiocarbonyl)]piperidine-1-carboxylate |