Ac4GalNAl structure
|
Common Name | Ac4GalNAl | ||
|---|---|---|---|---|
| CAS Number | 1673590-09-4 | Molecular Weight | 427.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ac4GalNAlAc4GalNAl is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Ac4GalNAl |
|---|
| Description | Ac4GalNAl is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H25NO10 |
|---|---|
| Molecular Weight | 427.40 |
| InChIKey | PODQGPKRSTUNAT-IQZDNPOKSA-N |
| SMILES | C#CCCC(=O)NC1C(OC(C)=O)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |