(1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate,hydrochloride structure
|
Common Name | (1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 16667-78-0 | Molecular Weight | 281.29100 | |
| Density | 2.4g/cm3 | Boiling Point | 713.2ºC at 760 mmHg | |
| Molecular Formula | C10H11N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 385.1ºC | |
| Name | (1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 2.4g/cm3 |
|---|---|
| Boiling Point | 713.2ºC at 760 mmHg |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.29100 |
| Flash Point | 385.1ºC |
| Exact Mass | 281.05800 |
| PSA | 144.61000 |
| Vapour Pressure | 2.4E-21mmHg at 25°C |
| Index of Refraction | 2.162 |
| InChIKey | DSPOATGVTLBRNQ-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2c1nc1n2C2OC(CO)C(S1)C2O |
|
~%
(1-methylpiperi... CAS#:16667-78-0 |
| Literature: Ikehara; Tada Chemical and pharmaceutical bulletin, 1967 , vol. 15, # 1 p. 94 - 100 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8,3'-Thioanhydroadenosine |
| 8,3'-Thiocycloadenosin |
| Epoxymanool |
| 8,3'-sulfanediyl-xylo-3'-deoxy-adenosine |
| 8,3'-S-Cycloadenosine |
| 8,20-epoxy-labd-14-en-13-ol |