Gallopamil hydrochloride
Modify Date: 2025-08-25 12:32:32
Gallopamil hydrochloride structure
|
Common Name | Gallopamil hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 16662-46-7 | Molecular Weight | 521.08900 | |
| Density | 1.068g/cm3 | Boiling Point | 605.9ºC at 760mmHg | |
| Molecular Formula | C28H41ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.2ºC | |
Use of Gallopamil hydrochlorideGallopamil hydrochloride (Methoxyverapamil hydrochloride), a methoxy derivative of Verapamil, is a phenylalkylamine calcium antagonist[1]. Gallopamil hydrochloride inhibits acid secretion in a concentration-dependent manner with an IC50 of 10.9 μM[2]. Gallopamil hydrochloride is a potent antiarrhythmic and vasodilator agent[3]. |
| Name | methoxyverapamil hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Gallopamil hydrochloride (Methoxyverapamil hydrochloride), a methoxy derivative of Verapamil, is a phenylalkylamine calcium antagonist[1]. Gallopamil hydrochloride inhibits acid secretion in a concentration-dependent manner with an IC50 of 10.9 μM[2]. Gallopamil hydrochloride is a potent antiarrhythmic and vasodilator agent[3]. |
|---|---|
| Related Catalog | |
| Target |
Ca2+ |
| In Vivo | Gallopamil hydrochloride (Methoxyverapamil hydrochloride; i.v.; 0.2 mg/kg; for 5 min) markedly reduces ventricular tachycardia (VT) and totally prevents fibrillation (VF). Gallopamil significantly reduces systolic and diastolic blood pressure measured 5 min after injection without markedly influencing heart rate[3]. Animal Model: Male Wistar rats weighing 290-370 g[3] Dosage: 0.2 mg/kg Administration: i.v.; 5 min Result: Markedly reduced VT and totally prevented VF. |
| References |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 605.9ºC at 760mmHg |
| Molecular Formula | C28H41ClN2O5 |
| Molecular Weight | 521.08900 |
| Flash Point | 320.2ºC |
| Exact Mass | 520.27000 |
| PSA | 73.18000 |
| LogP | 5.90368 |
| InChIKey | OKCRIUNHEQSXFD-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCN(C)CCCC(C#N)(c2cc(OC)c(OC)c(OC)c2)C(C)C)cc1OC.Cl |
| Storage condition | -20°C |
| WGK Germany | 3 |
|---|
| D600 |
| GALLOPAMIL |
| GALLOPAMIL HYDROCHLORIDE |
| D600,HCL |
| (S)-Gallopamil |
| (+/-)-METHOXYVERAPAMIL HCL |
| (+/-)-METHOXYVERAPAMIL,HYDROCHLORIDE |
| GALLOPAMIL HCL |
| D 600 HYDROCHLORIDE |