1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane
1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane structure
|
Common Name | 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 166330-00-3 | Molecular Weight | 254.16400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15BO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15BO2Si |
|---|---|
| Molecular Weight | 254.16400 |
| Exact Mass | 254.09300 |
| PSA | 18.46000 |
| LogP | 2.64000 |
| InChIKey | FXRZAYFYCLUHPP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(B1Oc2ccccc2O1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~67%
1,3,2-benzodiox... CAS#:166330-00-3 |
| Literature: Buynak, John D.; Geng, Bolin Organometallics, 1995 , vol. 14, p. 3112 - 3115 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,2-Benzodioxaborole,2-(dimethylphenylsilyl) |
| B-(phenyldimethylsilyl)catecholborane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: SMILES notation of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is C[Si](C)(B1Oc2ccccc2O1)c1ccccc1. |
| Q: What is the InChIKey of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: InChIKey of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is FXRZAYFYCLUHPP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: Molecular weight of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is 254.16400. |
| Q: What is the LogP of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: LogP of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is 2.64000. |
| Q: What is the polar surface area (PSA) of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: Polar surface area (PSA) of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is 18.46000. |
| Q: What is the CAS number of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: CAS number of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is 166330-00-3. |
| Q: What English synonyms does 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane have? |
| A: English synonyms of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane: 1,3,2-Benzodioxaborole,2-(dimethylphenylsilyl), B-(phenyldimethylsilyl)catecholborane. |
| Q: What is the molecular formula of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: Molecular formula of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is C14H15BO2Si. |
| Q: What is the English name of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane? |
| A: The English name of 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane is 1,3,2-benzodioxaborol-2-yl-dimethyl-phenylsilane. |
| Q: What is the Chinese name of 166330-00-3? |
| A: Chinese name of 166330-00-3 is 166330-00-3. |