Potassium (2,6-dichlorophenyl)trifluoroborate
Modify Date: 2025-09-08 18:20:28
Potassium (2,6-dichlorophenyl)trifluoroborate structure
|
Common Name | Potassium (2,6-dichlorophenyl)trifluoroborate | ||
|---|---|---|---|---|
| CAS Number | 166328-13-8 | Molecular Weight | 252.90 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3BCl2F3K | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Potassium (2,6-dichlorophenyl)trifluoroborate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3BCl2F3K |
|---|---|
| Molecular Weight | 252.90 |
| InChIKey | DZNYWXSADZMGTD-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)c1c(Cl)cccc1Cl.[K+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Potassium (2,6-dichlorophenyl)trifluoroborate? |
| A: Molecular formula of Potassium (2,6-dichlorophenyl)trifluoroborate is C6H3BCl2F3K. |
| Q: What is the English name of Potassium (2,6-dichlorophenyl)trifluoroborate? |
| A: The English name of Potassium (2,6-dichlorophenyl)trifluoroborate is Potassium (2,6-dichlorophenyl)trifluoroborate. |
| Q: What is the SMILES notation of Potassium (2,6-dichlorophenyl)trifluoroborate? |
| A: SMILES notation of Potassium (2,6-dichlorophenyl)trifluoroborate is F[B-](F)(F)c1c(Cl)cccc1Cl.[K+]. |
| Q: What is the InChIKey of Potassium (2,6-dichlorophenyl)trifluoroborate? |
| A: InChIKey of Potassium (2,6-dichlorophenyl)trifluoroborate is DZNYWXSADZMGTD-UHFFFAOYSA-N. |
| Q: What is the CAS number of Potassium (2,6-dichlorophenyl)trifluoroborate? |
| A: CAS number of Potassium (2,6-dichlorophenyl)trifluoroborate is 166328-13-8. |
| Q: What is the Chinese name of 166328-13-8? |
| A: Chinese name of 166328-13-8 is 166328-13-8. |
| Q: What is the molecular weight of Potassium (2,6-dichlorophenyl)trifluoroborate? |
| A: Molecular weight of Potassium (2,6-dichlorophenyl)trifluoroborate is 252.90. |