4-(4-METHYLPHENYL)-5-PYRIDIN-4-YL-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-(4-METHYLPHENYL)-5-PYRIDIN-4-YL-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 16629-43-9 | Molecular Weight | 268.33700 | |
| Density | 1.3g/cm3 | Boiling Point | 418.1ºC at 760mmHg | |
| Molecular Formula | C14H12N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | 4-(4-methylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 418.1ºC at 760mmHg |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.33700 |
| Flash Point | 206.7ºC |
| Exact Mass | 268.07800 |
| PSA | 82.40000 |
| LogP | 2.92640 |
| Vapour Pressure | 3.35E-07mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | MGRYIEKQCFTPFU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(-c3ccncc3)n[nH]c2=S)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-methylphenyl)-5-pyridin-4-yl-4H-1,2,4-triazole-3-thiol |
| 5-(4-pyridyl)-4-(p-tolyl)-4H-1,2,4-triazole-3-thiol |
| 5-pyridin-4-yl-4-p-tolyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 5-Pyridin-4-yl-4-p-tolyl-4H-[1,2,4]triazole-3-thiol |