Mal-PEG2-Val-Cit-PABA
Modify Date: 2025-10-04 11:56:38
Mal-PEG2-Val-Cit-PABA structure
|
Common Name | Mal-PEG2-Val-Cit-PABA | ||
|---|---|---|---|---|
| CAS Number | 1662687-83-3 | Molecular Weight | 590.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-PEG2-Val-Cit-PABAMal-PEG2-Val-Cit-PABA is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Mal-PEG2-Val-Cit-PABA |
|---|
| Description | Mal-PEG2-Val-Cit-PABA is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C27H38N6O9 |
|---|---|
| Molecular Weight | 590.63 |
| InChIKey | HTNGHIKQRXTBSP-REWPJTCUSA-N |
| SMILES | CC(C)C(NC(=O)OCCOCCN1C(=O)C=CC1=O)C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |