(4-fluorophenyl)-(4-phenoxyphenyl)methanone
Modify Date: 2025-08-26 07:05:28
(4-fluorophenyl)-(4-phenoxyphenyl)methanone structure
|
Common Name | (4-fluorophenyl)-(4-phenoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 16574-56-4 | Molecular Weight | 292.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-fluorophenyl)-(4-phenoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13FO2 |
|---|---|
| Molecular Weight | 292.30400 |
| Exact Mass | 292.09000 |
| PSA | 26.30000 |
| LogP | 4.84900 |
| InChIKey | FIQCCNZANIFEHY-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1ccc(Oc2ccccc2)cc1 |
|
~84%
(4-fluorophenyl... CAS#:16574-56-4 |
| Literature: Ridd, John H.; Yousaf, Taher I.; Rose, John B. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 1729 - 1734 |
| Methanone,(4-fluorophenyl)(4-phenoxyphenyl) |
| 4-fluoro-4'-phenoxybenzophenone |
| 4-phenoxy-4'-fluorobenzophenone |
| p-Phenoxy-p'-fluorbenzophenon |