Benzoic acid 4-[[(4-methoxyphenyl)methylene]amino]phenyl ester structure
|
Common Name | Benzoic acid 4-[[(4-methoxyphenyl)methylene]amino]phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 16571-39-4 | Molecular Weight | 331.36500 | |
| Density | 1.1g/cm3 | Boiling Point | 502.8ºC at 760mmHg | |
| Molecular Formula | C21H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | [4-[(4-methoxyphenyl)methylideneamino]phenyl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 502.8ºC at 760mmHg |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.36500 |
| Flash Point | 211.2ºC |
| Exact Mass | 331.12100 |
| PSA | 47.89000 |
| LogP | 4.66500 |
| Vapour Pressure | 3.09E-10mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | ZXGYKJZWIKJRHR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccc(OC(=O)c3ccccc3)cc2)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-benzoyloxy-4-(4-methoxy-benzylidenamino)-benzene |
| 1-Benzoyloxy-4-(4-methoxy-benzylidenamino)-benzol |
| Phenol,4-(((4-methoxyphenyl)methylene)amino)-,1-benzoate |
| Anisaldehyd-(4-benzoyloxy-anil) |
| Phenol,4-(((4-methoxyphenyl)methylene)amino)-,benzoate (ester) |
| (4-Anisylidenamino-phenyl)-benzoat |
| 4-Benzoyloxy-N-<4-methoxy-benzyliden>-anilin |