dnp-l-threonine
Modify Date: 2025-08-28 16:35:08
dnp-l-threonine structure
|
Common Name | dnp-l-threonine | ||
|---|---|---|---|---|
| CAS Number | 1655-65-8 | Molecular Weight | 285.21000 | |
| Density | 1.629g/cm3 | Boiling Point | 572ºC at 760mmHg | |
| Molecular Formula | C10H11N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.7ºC | |
| Name | (2S,3R)-2-(2,4-dinitroanilino)-3-hydroxybutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.629g/cm3 |
|---|---|
| Boiling Point | 572ºC at 760mmHg |
| Molecular Formula | C10H11N3O7 |
| Molecular Weight | 285.21000 |
| Flash Point | 299.7ºC |
| Exact Mass | 285.06000 |
| PSA | 161.20000 |
| LogP | 1.86830 |
| InChIKey | PWOCOTZWYFGDMO-UHFFFAOYSA-N |
| SMILES | CC(O)C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2922509090 |
|
~%
dnp-l-threonine CAS#:1655-65-8 |
| Literature: Porter; Sanger Biochemical Journal, 1948 , vol. 42, p. 287,288 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2,4-dinitro-phenyl)-DL-threonine |
| N-2,4-DINITROPHENYL-L-THREONINE |
| N-2-4-dnp-L-threonine |
| DNP-L-THREONINE |
| (+-)-threo-2-(2.4-Dinitro-anilino)-3-hydroxy-buttersaeure |
| L-Threonine,N-(2,4-dinitrophenyl) |