Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, ethyl ester
Modify Date: 2025-09-18 17:21:41
Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, ethyl ester structure
|
Common Name | Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 16546-01-3 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, ethyl ester |
|---|
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 48.06000 |
| LogP | 1.69820 |
| Vapour Pressure | 0.000509mmHg at 25°C |
| InChIKey | VLSGACWGKWLNCR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1OC1c1ccc(OC)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:5703-26-4| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |