Ethyl 2,2'-Bis(ethoxycarbonyl)-3-phenylpropanoate
Modify Date: 2024-01-03 19:06:59
Ethyl 2,2'-Bis(ethoxycarbonyl)-3-phenylpropanoate structure
|
Common Name | Ethyl 2,2'-Bis(ethoxycarbonyl)-3-phenylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 16515-84-7 | Molecular Weight | 322.35300 | |
| Density | 1.129g/cm3 | Boiling Point | 423.7ºC at 760 mmHg | |
| Molecular Formula | C17H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.2ºC | |
| Name | Ethyl 2,2'-Bis(ethoxycarbonyl)-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 423.7ºC at 760 mmHg |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.35300 |
| Flash Point | 183.2ºC |
| Exact Mass | 322.14200 |
| PSA | 78.90000 |
| LogP | 2.14820 |
| Vapour Pressure | 2.18E-07mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | RPNRGCZUORVKJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(Cc1ccccc1)(C(=O)OCC)C(=O)OCC |
| HS Code | 2917399090 |
|---|
|
~%
Ethyl 2,2'-Bis(... CAS#:16515-84-7 |
| Literature: WO2006/117800 A2, ; Page/Page column 6-7 ; |
|
~71%
Ethyl 2,2'-Bis(... CAS#:16515-84-7 |
| Literature: Cravotto, Giancarlo; Giovenzana, Giovanni B.; Sisti, Massimo; Palmisano, Giovanni Tetrahedron, 1996 , vol. 52, # 40 p. 13007 - 13016 |
|
~%
Ethyl 2,2'-Bis(... CAS#:16515-84-7 |
| Literature: Roczniki Chemii, , vol. 41, p. 267 - 273 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| triethyl 1-benzylethane-1,1,2-tricarboxylate |