3-(4-Benzyloxyphenyl)pentanedioic acid
Modify Date: 2025-09-29 15:56:17
3-(4-Benzyloxyphenyl)pentanedioic acid structure
|
Common Name | 3-(4-Benzyloxyphenyl)pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 165119-29-9 | Molecular Weight | 314.33300 | |
| Density | 1.275±0.06 g/cm3(Predicted) | Boiling Point | 501.9±45.0 °C(Predicted) | |
| Molecular Formula | C18H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-phenylmethoxyphenyl)pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 501.9±45.0 °C(Predicted) |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.33300 |
| Exact Mass | 314.11500 |
| PSA | 83.83000 |
| LogP | 3.29860 |
| Index of Refraction | 1.597 |
| InChIKey | GAAFBVUBUNMNOG-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(CC(=O)O)c1ccc(OCc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-Benzyloxyphenyl)pentanedioic acid |
| 2-(4-Benzyloxy-phenyl)-ethanol |