4-Chloro-6-(trifluoromethyl)quinazoline
Modify Date: 2025-08-26 11:56:37
4-Chloro-6-(trifluoromethyl)quinazoline structure
|
Common Name | 4-Chloro-6-(trifluoromethyl)quinazoline | ||
|---|---|---|---|---|
| CAS Number | 16499-64-2 | Molecular Weight | 232.590 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 285.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H4ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.7±25.9 °C | |
| Name | 4-Chloro-6-(trifluoromethyl)quinazoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.8±35.0 °C at 760 mmHg |
| Molecular Formula | C9H4ClF3N2 |
| Molecular Weight | 232.590 |
| Flash Point | 126.7±25.9 °C |
| Exact Mass | 232.001511 |
| PSA | 25.78000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | OJNBXNWWYXBHGZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2ncnc(Cl)c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
4-Chloro-6-(tri... CAS#:16499-64-2 |
| Literature: US2005/54627 A1, ; Page/Page column 41 ; US 20050054627 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quinazoline, 4-chloro-6-(trifluoromethyl)- |
| 4-Chloro-6-(trifluoromethyl)quinazoline |