Niometacin
Modify Date: 2025-09-18 22:25:13
Niometacin structure
|
Common Name | Niometacin | ||
|---|---|---|---|---|
| CAS Number | 16426-83-8 | Molecular Weight | 324.33100 | |
| Density | 1.3g/cm3 | Boiling Point | 485.3ºC at 760mmHg | |
| Molecular Formula | C18H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3ºC | |
| Name | 2-[5-methoxy-2-methyl-1-(pyridine-3-carbonyl)indol-3-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 485.3ºC at 760mmHg |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.33100 |
| Flash Point | 247.3ºC |
| Exact Mass | 324.11100 |
| PSA | 81.42000 |
| LogP | 2.66890 |
| Vapour Pressure | 3.12E-10mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | DDQOEXWUZHRSOZ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c1cccnc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Niometacinum |
| Niometacine [French] |
| Niometacine [INN-French] |
| Niometacin |
| Niometacin [INN] |
| <1-Nicotinoyl-2-methyl-5-methoxy-indolyl-(3)>-essigsaeure |
| (5-methoxy-2-methyl-1-nicotinoyl-indol-3-yl)-acetic acid |
| Niometacina |
| Niometacinum [Latin] |
| 5-Methoxy-2-methyl-1-nicotinoyl-indol-3-yl-essigsaeure |
| Niometacine |
| Niometacina [Spanish] |